C10H23N2O+ — CID 20608663
[3-(4,4-dimethylpentylamino)-3-oxopropyl]azanium (PubChem CID 20608663) has the molecular formula C10H23N2O+ and a molecular weight of 187.31 g/mol. Its IUPAC name is [3-(4,4-dimethylpentylamino)-3-oxopropyl]azanium.
| Compound Name | [3-(4,4-dimethylpentylamino)-3-oxopropyl]azanium |
|---|---|
| PubChem CID | 20608663 |
| Molecular Formula | C10H23N2O+ |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.18 |
| IUPAC Name | [3-(4,4-dimethylpentylamino)-3-oxopropyl]azanium |
| SMILES | CC(C)(C)CCCNC(=O)CC[NH3+] |
| InChI | InChI=1S/C10H22N2O/c1-10(2,3)6-4-8-12-9(13)5-7-11/h4-8,11H2,1-3H3,(H,12,13)/p+1 |
| InChIKey | FNSGAIOBSRQCHK-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|