C24H32N2 — CID 20609224
N,N'-dipentyl-1,2-diphenylethane-1,2-diimine (PubChem CID 20609224) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N,N'-dipentyl-1,2-diphenylethane-1,2-diimine.
| Compound Name | N,N'-dipentyl-1,2-diphenylethane-1,2-diimine |
|---|---|
| PubChem CID | 20609224 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N,N'-dipentyl-1,2-diphenylethane-1,2-diimine |
| SMILES | CCCCC/N=C(C(=N/CCCCC)/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C24H32N2/c1-3-5-13-19-25-23(21-15-9-7-10-16-21)24(26-20-14-6-4-2)22-17-11-8-12-18-22/h7-12,15-18H,3-6,13-14,19-20H2,1-2H3/b25-23+,26-24+ |
| InChIKey | OZAHPMYGQCNSDZ-OGGGYYITSA-N |
| XLogP | 6.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|