C14H23BrN2O3 — CID 20610322
tert-butyl N-[1-[5-(bromomethyl)-1,2-oxazol-3-yl]-3-methylbutyl]carbamate (PubChem CID 20610322) has the molecular formula C14H23BrN2O3 and a molecular weight of 347.25 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(bromomethyl)-1,2-oxazol-3-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(bromomethyl)-1,2-oxazol-3-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 20610322 |
| Molecular Formula | C14H23BrN2O3 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | tert-butyl N-[1-[5-(bromomethyl)-1,2-oxazol-3-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)c1cc(CBr)on1 |
| InChI | InChI=1S/C14H23BrN2O3/c1-9(2)6-11(12-7-10(8-15)20-17-12)16-13(18)19-14(3,4)5/h7,9,11H,6,8H2,1-5H3,(H,16,18) |
| InChIKey | FESCJSHZDYGLFA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|