C24H27N3O4 — CID 20610983
2-[4-phenyl-2-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]imidazol-1-yl]acetic acid (PubChem CID 20610983) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[4-phenyl-2-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]imidazol-1-yl]acetic acid.
| Compound Name | 2-[4-phenyl-2-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]imidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 20610983 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[4-phenyl-2-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]imidazol-1-yl]acetic acid |
| SMILES | CCCC[C@H](NC(=O)OCc1ccccc1)c1nc(-c2ccccc2)cn1CC(=O)O |
| InChI | InChI=1S/C24H27N3O4/c1-2-3-14-20(26-24(30)31-17-18-10-6-4-7-11-18)23-25-21(15-27(23)16-22(28)29)19-12-8-5-9-13-19/h4-13,15,20H,2-3,14,16-17H2,1H3,(H,26,30)(H,28,29)/t20-/m0/s1 |
| InChIKey | ONANPLBZQIAAQB-FQEVSTJZSA-N |
| XLogP | 4.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |