C27H29N3O2 — CID 142744379
benzyl N-[1-(2-phenylimidazo[1,2-a]pyridin-3-yl)hexyl]carbamate (PubChem CID 142744379) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is benzyl N-[1-(2-phenylimidazo[1,2-a]pyridin-3-yl)hexyl]carbamate.
| Compound Name | benzyl N-[1-(2-phenylimidazo[1,2-a]pyridin-3-yl)hexyl]carbamate |
|---|---|
| PubChem CID | 142744379 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | benzyl N-[1-(2-phenylimidazo[1,2-a]pyridin-3-yl)hexyl]carbamate |
| SMILES | CCCCCC(NC(=O)OCc1ccccc1)c1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C27H29N3O2/c1-2-3-6-17-23(28-27(31)32-20-21-13-7-4-8-14-21)26-25(22-15-9-5-10-16-22)29-24-18-11-12-19-30(24)26/h4-5,7-16,18-19,23H,2-3,6,17,20H2,1H3,(H,28,31) |
| InChIKey | SZMHNXDPCFEWLI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|