C22H26N4O5 — CID 20616301
3-[[4-[4-[(2-methylphenyl)carbamoylamino]anilino]-4-oxobutanoyl]amino]butanoic acid (PubChem CID 20616301) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[[4-[4-[(2-methylphenyl)carbamoylamino]anilino]-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 3-[[4-[4-[(2-methylphenyl)carbamoylamino]anilino]-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 20616301 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[[4-[4-[(2-methylphenyl)carbamoylamino]anilino]-4-oxobutanoyl]amino]butanoic acid |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(NC(=O)CCC(=O)NC(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C22H26N4O5/c1-14-5-3-4-6-18(14)26-22(31)25-17-9-7-16(8-10-17)24-20(28)12-11-19(27)23-15(2)13-21(29)30/h3-10,15H,11-13H2,1-2H3,(H,23,27)(H,24,28)(H,29,30)(H2,25,26,31) |
| InChIKey | LXTYCHDYLLBBJL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |