C33H24N2O3S — CID 20617878
2-[(5Z)-3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]indene-1,3-dione (PubChem CID 20617878) has the molecular formula C33H24N2O3S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[(5Z)-3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]indene-1,3-dione.
| Compound Name | 2-[(5Z)-3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 20617878 |
| Molecular Formula | C33H24N2O3S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 2-[(5Z)-3-ethyl-4-oxo-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]indene-1,3-dione |
| SMILES | CCn1c(=C2C(=O)c3ccccc3C2=O)s/c(=C\c2ccc(N(c3ccccc3)c3ccccc3)cc2)c1=O |
| InChI | InChI=1S/C33H24N2O3S/c1-2-34-32(38)28(39-33(34)29-30(36)26-15-9-10-16-27(26)31(29)37)21-22-17-19-25(20-18-22)35(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-21H,2H2,1H3/b28-21- |
| InChIKey | DJMXJKQIHVLOKT-HFTWOUSFSA-N |
| XLogP | 5.46 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'} |
|---|