C26H24ClN5O2S2 — CID 20618832
4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-N-[3-[(4-chloroanilino)methyl]-4-(1-ethoxyethenyl)phenyl]benzamide (PubChem CID 20618832) has the molecular formula C26H24ClN5O2S2 and a molecular weight of 538.10 g/mol. Its IUPAC name is 4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-N-[3-[(4-chloroanilino)methyl]-4-(1-ethoxyethenyl)phenyl]benzamide.
| Compound Name | 4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-N-[3-[(4-chloroanilino)methyl]-4-(1-ethoxyethenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 20618832 |
| Molecular Formula | C26H24ClN5O2S2 |
| Molecular Weight | 538.10 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-N-[3-[(4-chloroanilino)methyl]-4-(1-ethoxyethenyl)phenyl]benzamide |
| SMILES | C=C(OCC)c1ccc(NC(=O)c2ccc(-n3c(=S)[nH][nH]c3=S)cc2)cc1CNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN5O2S2/c1-3-34-16(2)23-13-10-21(14-18(23)15-28-20-8-6-19(27)7-9-20)29-24(33)17-4-11-22(12-5-17)32-25(35)30-31-26(32)36/h4-14,28H,2-3,15H2,1H3,(H,29,33)(H,30,35)(H,31,36) |
| InChIKey | VVGPOKCNVFANRG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.10 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|