C6H13BN2O2 — CID 20619301
(5-hydroxy-2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)-methylborinic acid (PubChem CID 20619301) has the molecular formula C6H13BN2O2 and a molecular weight of 155.99 g/mol. Its IUPAC name is (5-hydroxy-2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)-methylborinic acid.
| Compound Name | (5-hydroxy-2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)-methylborinic acid |
|---|---|
| PubChem CID | 20619301 |
| Molecular Formula | C6H13BN2O2 |
| Molecular Weight | 155.99 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (5-hydroxy-2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)-methylborinic acid |
| SMILES | CB(O)N1CC(O)CN=C1C |
| InChI | InChI=1S/C6H13BN2O2/c1-5-8-3-6(10)4-9(5)7(2)11/h6,10-11H,3-4H2,1-2H3 |
| InChIKey | JWIUPOGMVBETMU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.99 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|