About 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol
6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol (PubChem CID 45083155) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol.
Analyze 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol?
The IUPAC name of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol (CID 45083155) is 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol.
What is the SMILES notation for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol?
The canonical SMILES for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol is OC1CN=C2SC=CN2C1.
What is the InChIKey of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol?
The InChIKey is YFQGESUKUNFUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c9-5-3-7-6-8(4-5)1-2-10-6/h1-2,5,9H,3-4H2.
What are the key properties of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol?
6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol has a molecular weight of 156.21 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-ol is sourced from PubChem (CID 45083155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).