C7H10N2OS — CID 82412374
1-(1,2-thiazol-5-ylmethyl)azetidin-3-ol (PubChem CID 82412374) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-ylmethyl)azetidin-3-ol.
| Compound Name | 1-(1,2-thiazol-5-ylmethyl)azetidin-3-ol |
|---|---|
| PubChem CID | 82412374 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-(1,2-thiazol-5-ylmethyl)azetidin-3-ol |
| SMILES | OC1CN(Cc2ccns2)C1 |
| InChI | InChI=1S/C7H10N2OS/c10-6-3-9(4-6)5-7-1-2-8-11-7/h1-2,6,10H,3-5H2 |
| InChIKey | QNKJECGMMKKCKK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |