C5H9NO — CID 175914585
5-methyl-3,4-dihydro-2H-pyrrol-3-ol (PubChem CID 175914585) has the molecular formula C5H9NO and a molecular weight of 99.13 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-pyrrol-3-ol.
| Compound Name | 5-methyl-3,4-dihydro-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 175914585 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-pyrrol-3-ol |
| SMILES | CC1=NCC(O)C1 |
| InChI | InChI=1S/C5H9NO/c1-4-2-5(7)3-6-4/h5,7H,2-3H2,1H3 |
| InChIKey | MWBVGRPCUULVTO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |