About 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine
2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine (PubChem CID 55299106) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine.
Analyze 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine?
The IUPAC name of 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine (CID 55299106) is 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine.
What is the SMILES notation for 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine?
The canonical SMILES for 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine is CC1=NCC(C)NCC1.
What is the InChIKey of 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine?
The InChIKey is GOYLKYWNYZWEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-6-3-4-8-7(2)5-9-6/h7-8H,3-5H2,1-2H3.
What are the key properties of 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine?
2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine has a molecular weight of 126.20 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2,3,6,7-tetrahydro-1H-1,4-diazepine is sourced from PubChem (CID 55299106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).