C8H12N2O — CID 124505716
(4R)-2,4-dimethyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 124505716) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (4R)-2,4-dimethyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | (4R)-2,4-dimethyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 124505716 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (4R)-2,4-dimethyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | Cc1nc2c(o1)[C@@H](C)NCC2 |
| InChI | InChI=1S/C8H12N2O/c1-5-8-7(3-4-9-5)10-6(2)11-8/h5,9H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | MNHZCEFVMWWYNK-RXMQYKEDSA-N |
| XLogP | 1.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |