C4H8N3S- — CID 86318626
(4R)-4,5-dimethyl-3-sulfido-2,4-dihydrotriazole (PubChem CID 86318626) has the molecular formula C4H8N3S- and a molecular weight of 130.20 g/mol. Its IUPAC name is (4R)-4,5-dimethyl-3-sulfido-2,4-dihydrotriazole.
| Compound Name | (4R)-4,5-dimethyl-3-sulfido-2,4-dihydrotriazole |
|---|---|
| PubChem CID | 86318626 |
| Molecular Formula | C4H8N3S- |
| Molecular Weight | 130.20 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | (4R)-4,5-dimethyl-3-sulfido-2,4-dihydrotriazole |
| SMILES | CC1=NNN([S-])[C@@H]1C |
| InChI | InChI=1S/C4H8N3S/c1-3-4(2)7(8)6-5-3/h4,6H,1-2H3/q-1/t4-/m1/s1 |
| InChIKey | SEYNGAWHYYHXFW-SCSAIBSYSA-N |
| XLogP | 0.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|