C12H16N6O2 — CID 51476783
(4R)-7-ethyl-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 51476783) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is (4R)-7-ethyl-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4R)-7-ethyl-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 51476783 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (4R)-7-ethyl-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3)n(C)c1=O |
| InChI | InChI=1S/C12H16N6O2/c1-5-17-10(19)8-9(16(4)12(17)20)13-11-15-14-6(2)7(3)18(8)11/h7H,5H2,1-4H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | GXHQXKSRWPFJHR-SSDOTTSWSA-N |
| XLogP | 0.28 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |