C19H20N6O2 — CID 40798045
(4R)-3,4,9-trimethyl-7-[(E)-3-phenylprop-2-enyl]-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 40798045) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (4R)-3,4,9-trimethyl-7-[(E)-3-phenylprop-2-enyl]-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4R)-3,4,9-trimethyl-7-[(E)-3-phenylprop-2-enyl]-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 40798045 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (4R)-3,4,9-trimethyl-7-[(E)-3-phenylprop-2-enyl]-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NNc2nc3c(c(=O)n(C/C=C/c4ccccc4)c(=O)n3C)n2[C@@H]1C |
| InChI | InChI=1S/C19H20N6O2/c1-12-13(2)25-15-16(20-18(25)22-21-12)23(3)19(27)24(17(15)26)11-7-10-14-8-5-4-6-9-14/h4-10,13H,11H2,1-3H3,(H,20,22)/b10-7+/t13-/m1/s1 |
| InChIKey | DNXAGFZMVNDEJR-UTSBKAFOSA-N |
| XLogP | 1.97 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |