C14H18N6O2 — CID 98442523
(4S)-7-[(Z)-but-2-enyl]-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 98442523) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is (4S)-7-[(Z)-but-2-enyl]-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4S)-7-[(Z)-but-2-enyl]-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 98442523 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (4S)-7-[(Z)-but-2-enyl]-3,4,9-trimethyl-1,4-dihydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | C/C=C\Cn1c(=O)c2c(nc3n2[C@@H](C)C(C)=NN3)n(C)c1=O |
| InChI | InChI=1S/C14H18N6O2/c1-5-6-7-19-12(21)10-11(18(4)14(19)22)15-13-17-16-8(2)9(3)20(10)13/h5-6,9H,7H2,1-4H3,(H,15,17)/b6-5-/t9-/m0/s1 |
| InChIKey | JVIRTACXWPQCCW-UDIARPCQSA-N |
| XLogP | 0.84 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|