About 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol
6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol (PubChem CID 175018072) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol.
Analyze 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol?
The IUPAC name of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol (CID 175018072) is 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol.
What is the SMILES notation for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol?
The canonical SMILES for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol is OC1CC(O)N2C=CSC2=N1.
What is the InChIKey of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol?
The InChIKey is QWENRSWFHZQSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c9-4-3-5(10)8-1-2-11-6(8)7-4/h1-2,4-5,9-10H,3H2.
What are the key properties of 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol?
6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol has a molecular weight of 172.21 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-5,7-diol is sourced from PubChem (CID 175018072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).