About 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine
5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine (PubChem CID 89355373) has the molecular formula C6H8N2S
and a molecular weight of 140.21 g/mol. Its IUPAC name is 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine.
Analyze 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine (CID 89355373) is 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine is NC1CC=C2SC=CN21.
What is the InChIKey of 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is MOZOHQWCQBIAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S/c7-5-1-2-6-8(5)3-4-9-6/h2-5H,1,7H2.
What are the key properties of 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine?
5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 140.21 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydropyrrolo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 89355373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).