C4H7N5S — CID 21107802
3H-[1,3]thiazolo[2,3-c][1,2,4]triazole-2,3-diamine (PubChem CID 21107802) has the molecular formula C4H7N5S and a molecular weight of 157.20 g/mol. Its IUPAC name is 3H-[1,3]thiazolo[2,3-c][1,2,4]triazole-2,3-diamine.
| Compound Name | 3H-[1,3]thiazolo[2,3-c][1,2,4]triazole-2,3-diamine |
|---|---|
| PubChem CID | 21107802 |
| Molecular Formula | C4H7N5S |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 3H-[1,3]thiazolo[2,3-c][1,2,4]triazole-2,3-diamine |
| SMILES | NC1N(N)N=C2SC=CN21 |
| InChI | InChI=1S/C4H7N5S/c5-3-8-1-2-10-4(8)7-9(3)6/h1-3H,5-6H2 |
| InChIKey | VKBSZKHEVHGLEJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|