About 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride
5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride (PubChem CID 169005273) has the molecular formula C10H10Cl2N2S
and a molecular weight of 261.18 g/mol. Its IUPAC name is 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride.
Molecular Properties
| Compound Name | 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride |
| PubChem CID | 169005273 |
| Molecular Formula | C10H10Cl2N2S |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride |
| SMILES | C1=CN2Cc3ccccc3N=C2S1.Cl.Cl |
| InChI | InChI=1S/C10H8N2S.2ClH/c1-2-4-9-8(3-1)7-12-5-6-13-10(12)11-9;;/h1-6H,7H2;2*1H |
| InChIKey | DXFQJTLQROGYTJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride?
The IUPAC name of 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride (CID 169005273) is 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride.
What is the SMILES notation for 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride?
The canonical SMILES for 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride is C1=CN2Cc3ccccc3N=C2S1.Cl.Cl.
What is the InChIKey of 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride?
The InChIKey is DXFQJTLQROGYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S.2ClH/c1-2-4-9-8(3-1)7-12-5-6-13-10(12)11-9;;/h1-6H,7H2;2*1H.
What are the key properties of 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride?
5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride has a molecular weight of 261.18 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-[1,3]thiazolo[2,3-b]quinazoline;dihydrochloride is sourced from PubChem (CID 169005273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).