C16H13N3OS — CID 21090613
2-(4-aminophenyl)-5H-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 21090613) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5H-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | 2-(4-aminophenyl)-5H-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 21090613 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(4-aminophenyl)-5H-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | Nc1ccc(C2SC3=Nc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C16H13N3OS/c17-12-7-5-10(6-8-12)14-15(20)19-9-11-3-1-2-4-13(11)18-16(19)21-14/h1-8,14H,9,17H2 |
| InChIKey | SYTGQAFILIUMTC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|