C11H9N3 — CID 86175135
6H-pyrazino[2,1-b]quinazoline (PubChem CID 86175135) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6H-pyrazino[2,1-b]quinazoline.
| Compound Name | 6H-pyrazino[2,1-b]quinazoline |
|---|---|
| PubChem CID | 86175135 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 6H-pyrazino[2,1-b]quinazoline |
| SMILES | C1=CN2Cc3ccccc3N=C2C=N1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-10-9(3-1)8-14-6-5-12-7-11(14)13-10/h1-7H,8H2 |
| InChIKey | SYZRCGZLVGBQCM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |