C11H10N2 — CID 67371451
1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaene (PubChem CID 67371451) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaene.
| Compound Name | 1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 67371451 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaene |
| SMILES | C1=CN2CCc3cccc(c32)C=N1 |
| InChI | InChI=1S/C11H10N2/c1-2-9-4-6-13-7-5-12-8-10(3-1)11(9)13/h1-3,5,7-8H,4,6H2 |
| InChIKey | PXQHFFYZINHPRQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |