C10H12N2 — CID 53232186
3-methyl-4,5-dihydro-2,3-benzodiazepine (PubChem CID 53232186) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-methyl-4,5-dihydro-2,3-benzodiazepine.
| Compound Name | 3-methyl-4,5-dihydro-2,3-benzodiazepine |
|---|---|
| PubChem CID | 53232186 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-methyl-4,5-dihydro-2,3-benzodiazepine |
| SMILES | CN1CCc2ccccc2C=N1 |
| InChI | InChI=1S/C10H12N2/c1-12-7-6-9-4-2-3-5-10(9)8-11-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | YGCBNKFTEOXRLQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |