C10H10N2OS — CID 87758009
4,5-dihydro-2,3-benzodiazepine-3-carbothioic S-acid (PubChem CID 87758009) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 4,5-dihydro-2,3-benzodiazepine-3-carbothioic S-acid.
| Compound Name | 4,5-dihydro-2,3-benzodiazepine-3-carbothioic S-acid |
|---|---|
| PubChem CID | 87758009 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4,5-dihydro-2,3-benzodiazepine-3-carbothioic S-acid |
| SMILES | O=C(S)N1CCc2ccccc2C=N1 |
| InChI | InChI=1S/C10H10N2OS/c13-10(14)12-6-5-8-3-1-2-4-9(8)7-11-12/h1-4,7H,5-6H2,(H,13,14) |
| InChIKey | LHSADCIPIMTZPK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|