About 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene
9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene (PubChem CID 173255580) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene.
Analyze 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The IUPAC name of 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene (CID 173255580) is 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene.
What is the SMILES notation for 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The canonical SMILES for 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene is C1=CN2CCc3cccc(c32)S1.
What is the InChIKey of 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The InChIKey is JMJCBIWTKQMPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c1-2-8-4-5-11-6-7-12-9(3-1)10(8)11/h1-3,6-7H,4-5H2.
What are the key properties of 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene has a molecular weight of 175.26 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-thia-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene is sourced from PubChem (CID 173255580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).