C17H18N2 — CID 54152678
(2S)-10,13-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),7,9,11,15,17-hexaene (PubChem CID 54152678) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is (2S)-10,13-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),7,9,11,15,17-hexaene.
| Compound Name | (2S)-10,13-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),7,9,11,15,17-hexaene |
|---|---|
| PubChem CID | 54152678 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (2S)-10,13-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),7,9,11,15,17-hexaene |
| SMILES | C1=CN2Cc3ccccc3[C@@H]3CCCCC3=C2C=N1 |
| InChI | InChI=1S/C17H18N2/c1-2-6-14-13(5-1)12-19-10-9-18-11-17(19)16-8-4-3-7-15(14)16/h1-2,5-6,9-11,15H,3-4,7-8,12H2/t15-/m0/s1 |
| InChIKey | OIVMGDORYIUBKV-HNNXBMFYSA-N |
| XLogP | 3.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |