About 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole
4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 155166553) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole.
Analyze 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole?
The IUPAC name of 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole (CID 155166553) is 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole.
What is the SMILES notation for 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole?
The canonical SMILES for 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole is C1=CN2C3=CCCCC3N=C2S1.
What is the InChIKey of 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole?
The InChIKey is VEUOEKLJYGMQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-2-4-8-7(3-1)10-9-11(8)5-6-12-9/h4-7H,1-3H2.
What are the key properties of 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole?
4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole has a molecular weight of 178.26 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole is sourced from PubChem (CID 155166553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).