C8H13N3O — CID 89489619
O-(3a,4,5,6-tetrahydro-1H-benzimidazol-2-ylmethyl)hydroxylamine (PubChem CID 89489619) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is O-(3a,4,5,6-tetrahydro-1H-benzimidazol-2-ylmethyl)hydroxylamine.
| Compound Name | O-(3a,4,5,6-tetrahydro-1H-benzimidazol-2-ylmethyl)hydroxylamine |
|---|---|
| PubChem CID | 89489619 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | O-(3a,4,5,6-tetrahydro-1H-benzimidazol-2-ylmethyl)hydroxylamine |
| SMILES | NOCC1=NC2CCCC=C2N1 |
| InChI | InChI=1S/C8H13N3O/c9-12-5-8-10-6-3-1-2-4-7(6)11-8/h3,7H,1-2,4-5,9H2,(H,10,11) |
| InChIKey | GYLXJLJNRVPAQL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|