C6H14N4 — CID 131871119
1,3-dimethyl-2,4-dihydropyrimidine-4,5-diamine (PubChem CID 131871119) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dihydropyrimidine-4,5-diamine.
| Compound Name | 1,3-dimethyl-2,4-dihydropyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 131871119 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 1,3-dimethyl-2,4-dihydropyrimidine-4,5-diamine |
| SMILES | CN1C=C(N)C(N)N(C)C1 |
| InChI | InChI=1S/C6H14N4/c1-9-3-5(7)6(8)10(2)4-9/h3,6H,4,7-8H2,1-2H3 |
| InChIKey | ZMKORVAEMKZHBW-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |