C5H12ClN5 — CID 173207499
4-(aminodiazenyl)-1,3-dimethyl-2H-imidazole;hydrochloride (PubChem CID 173207499) has the molecular formula C5H12ClN5 and a molecular weight of 177.64 g/mol. Its IUPAC name is 4-(aminodiazenyl)-1,3-dimethyl-2H-imidazole;hydrochloride.
| Compound Name | 4-(aminodiazenyl)-1,3-dimethyl-2H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 173207499 |
| Molecular Formula | C5H12ClN5 |
| Molecular Weight | 177.64 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-(aminodiazenyl)-1,3-dimethyl-2H-imidazole;hydrochloride |
| SMILES | CN1C=C(N=NN)N(C)C1.Cl |
| InChI | InChI=1S/C5H11N5.ClH/c1-9-3-5(7-8-6)10(2)4-9;/h3H,4H2,1-2H3,(H2,6,7);1H |
| InChIKey | CESDSTNVLCNVGE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 57.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.64 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|