C4H8N4O — CID 136626142
(2E)-2-hydrazinylidene-1-methylimidazolidin-4-one (PubChem CID 136626142) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is (2E)-2-hydrazinylidene-1-methylimidazolidin-4-one.
| Compound Name | (2E)-2-hydrazinylidene-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 136626142 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (2E)-2-hydrazinylidene-1-methylimidazolidin-4-one |
| SMILES | CN1CC(=O)N/C1=N\N |
| InChI | InChI=1S/C4H8N4O/c1-8-2-3(9)6-4(8)7-5/h2,5H2,1H3,(H,6,7,9) |
| InChIKey | DYEVREWWICEGRK-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|