C9H15N3O3 — CID 139392415
tert-butyl (NE)-N-(1-methyl-4-oxoimidazolidin-2-ylidene)carbamate (PubChem CID 139392415) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is tert-butyl (NE)-N-(1-methyl-4-oxoimidazolidin-2-ylidene)carbamate.
| Compound Name | tert-butyl (NE)-N-(1-methyl-4-oxoimidazolidin-2-ylidene)carbamate |
|---|---|
| PubChem CID | 139392415 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | tert-butyl (NE)-N-(1-methyl-4-oxoimidazolidin-2-ylidene)carbamate |
| SMILES | CN1CC(=O)N/C1=N\C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15N3O3/c1-9(2,3)15-8(14)11-7-10-6(13)5-12(7)4/h5H2,1-4H3,(H,10,11,13,14) |
| InChIKey | RPXGHTVTXMRQDI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|