C22H37N3O5 — CID 156632454
tert-butyl (NZ)-N-[(15Z)-17-ethyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-15-en-5-ylidene]carbamate (PubChem CID 156632454) has the molecular formula C22H37N3O5 and a molecular weight of 426.57 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(15Z)-17-ethyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-15-en-5-ylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(15Z)-17-ethyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-15-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 156632454 |
| Molecular Formula | C22H37N3O5 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | tert-butyl (NZ)-N-[(15Z)-17-ethyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-15-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OC(CC)/C=C\CCCCCCCC(=O)N/C1=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N3O5/c1-6-17-14-12-10-8-7-9-11-13-15-18(26)23-20(25(5)16-19(27)29-17)24-21(28)30-22(2,3)4/h12,14,17H,6-11,13,15-16H2,1-5H3,(H,23,24,26,28)/b14-12-/i5D3 |
| InChIKey | MVCLBRXZIIVPNS-DTDHJPGMSA-N |
| XLogP | 3.95 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|