C20H33N3O5 — CID 155759924
tert-butyl (NZ)-N-[(12Z)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate (PubChem CID 155759924) has the molecular formula C20H33N3O5 and a molecular weight of 398.52 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(12Z)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(12Z)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 155759924 |
| Molecular Formula | C20H33N3O5 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | tert-butyl (NZ)-N-[(12Z)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OCCCC/C=C\CCCCC(=O)N/C1=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33N3O5/c1-20(2,3)28-19(26)22-18-21-16(24)13-11-9-7-5-6-8-10-12-14-27-17(25)15-23(18)4/h5-6H,7-15H2,1-4H3,(H,21,22,24,26)/b6-5-/i4D3 |
| InChIKey | OVVWHZMBXOYSRI-DIEJGQGKSA-N |
| XLogP | 3.17 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|