C22H37N3O5 — CID 174112993
tert-butyl N-[(15E)-4,18-dimethyl-2,7-dioxo-1-oxa-4,6-diazacyclooctadec-15-en-5-ylidene]carbamate (PubChem CID 174112993) has the molecular formula C22H37N3O5 and a molecular weight of 423.55 g/mol. Its IUPAC name is tert-butyl N-[(15E)-4,18-dimethyl-2,7-dioxo-1-oxa-4,6-diazacyclooctadec-15-en-5-ylidene]carbamate.
| Compound Name | tert-butyl N-[(15E)-4,18-dimethyl-2,7-dioxo-1-oxa-4,6-diazacyclooctadec-15-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 174112993 |
| Molecular Formula | C22H37N3O5 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | tert-butyl N-[(15E)-4,18-dimethyl-2,7-dioxo-1-oxa-4,6-diazacyclooctadec-15-en-5-ylidene]carbamate |
| SMILES | CC1C/C=C/CCCCCCCC(=O)NC(=NC(=O)OC(C)(C)C)N(C)CC(=O)O1 |
| InChI | InChI=1S/C22H37N3O5/c1-17-14-12-10-8-6-7-9-11-13-15-18(26)23-20(25(5)16-19(27)29-17)24-21(28)30-22(2,3)4/h10,12,17H,6-9,11,13-16H2,1-5H3,(H,23,24,26,28)/b12-10+ |
| InChIKey | RTSYUMKHWATTGX-ZRDIBKRKSA-N |
| XLogP | 3.95 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|