C25H33N3O5 — CID 155759987
benzyl (NZ)-N-[(11Z)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamate (PubChem CID 155759987) has the molecular formula C25H33N3O5 and a molecular weight of 458.57 g/mol. Its IUPAC name is benzyl (NZ)-N-[(11Z)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamate.
| Compound Name | benzyl (NZ)-N-[(11Z)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 155759987 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | benzyl (NZ)-N-[(11Z)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OC(C2CC2)CCC/C=C\CCCC(=O)N/C1=N/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H33N3O5/c1-28-17-23(30)33-21(20-15-16-20)13-9-4-2-3-5-10-14-22(29)26-24(28)27-25(31)32-18-19-11-7-6-8-12-19/h2-3,6-8,11-12,20-21H,4-5,9-10,13-18H2,1H3,(H,26,27,29,31)/b3-2-/i1D3 |
| InChIKey | NECYUILGXKSQMD-CZENPIIFSA-N |
| XLogP | 3.96 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|