C24H33N3O5 — CID 155760079
benzyl (NZ)-N-[(12E)-2,7-dioxo-15-propyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadec-12-en-5-ylidene]carbamate (PubChem CID 155760079) has the molecular formula C24H33N3O5 and a molecular weight of 446.56 g/mol. Its IUPAC name is benzyl (NZ)-N-[(12E)-2,7-dioxo-15-propyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadec-12-en-5-ylidene]carbamate.
| Compound Name | benzyl (NZ)-N-[(12E)-2,7-dioxo-15-propyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadec-12-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 155760079 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | benzyl (NZ)-N-[(12E)-2,7-dioxo-15-propyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadec-12-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OC(CCC)C/C=C/CCCCC(=O)N/C1=N/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33N3O5/c1-3-12-20-15-10-5-4-6-11-16-21(28)25-23(27(2)17-22(29)32-20)26-24(30)31-18-19-13-8-7-9-14-19/h5,7-10,13-14,20H,3-4,6,11-12,15-18H2,1-2H3,(H,25,26,28,30)/b10-5+/i2D3 |
| InChIKey | CKSFPFZOYZRTTH-SHDKUFAKSA-N |
| XLogP | 3.96 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|