C21H35N3O5 — CID 172736870
tert-butyl N-[(12E,17R)-17-methyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate (PubChem CID 172736870) has the molecular formula C21H35N3O5 and a molecular weight of 412.55 g/mol. Its IUPAC name is tert-butyl N-[(12E,17R)-17-methyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate.
| Compound Name | tert-butyl N-[(12E,17R)-17-methyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 172736870 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl N-[(12E,17R)-17-methyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadec-12-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)O[C@H](C)CCC/C=C/CCCCC(=O)NC1=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N3O5/c1-16-13-11-9-7-6-8-10-12-14-17(25)22-19(24(5)15-18(26)28-16)23-20(27)29-21(2,3)4/h6-7,16H,8-15H2,1-5H3,(H,22,23,25,27)/b7-6+/t16-/m1/s1/i5D3 |
| InChIKey | IOEWDKVBRLPGAT-IGWDUONZSA-N |
| XLogP | 3.56 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|