C30H42N6O8 — CID 165004061
benzyl N-[(10E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridec-10-en-5-ylidene]carbamate;5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridecane-2,7-dione (PubChem CID 165004061) has the molecular formula C30H42N6O8 and a molecular weight of 620.74 g/mol. Its IUPAC name is benzyl N-[(10E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridec-10-en-5-ylidene]carbamate;5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridecane-2,7-dione.
| Compound Name | benzyl N-[(10E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridec-10-en-5-ylidene]carbamate;5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridecane-2,7-dione |
|---|---|
| PubChem CID | 165004061 |
| Molecular Formula | C30H42N6O8 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | benzyl N-[(10E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridec-10-en-5-ylidene]carbamate;5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotridecane-2,7-dione |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OCC/C=C/CCC(=O)NC1=NC(=O)OCc1ccccc1.[H]/N=C1\NC(=O)CCCCCCOC(=O)CN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H23N3O5.C11H19N3O3/c1-22-13-17(24)26-12-8-3-2-7-11-16(23)20-18(22)21-19(25)27-14-15-9-5-4-6-10-15;1-14-8-10(16)17-7-5-3-2-4-6-9(15)13-11(14)12/h2-6,9-10H,7-8,11-14H2,1H3,(H,20,21,23,25);2-8H2,1H3,(H2,12,13,15)/b3-2+;/i2*1D3 |
| InChIKey | IRRCQPSULWVYNW-FPGSIHDJSA-N |
| XLogP | 2.49 |
| TPSA | 179.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|