C17H27N3O5 — CID 155759956
tert-butyl (NZ)-N-[(11E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotetradec-11-en-5-ylidene]carbamate (PubChem CID 155759956) has the molecular formula C17H27N3O5 and a molecular weight of 356.44 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(11E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotetradec-11-en-5-ylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(11E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotetradec-11-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 155759956 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl (NZ)-N-[(11E)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclotetradec-11-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OCC/C=C/CCCC(=O)N/C1=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O5/c1-17(2,3)25-16(23)19-15-18-13(21)10-8-6-5-7-9-11-24-14(22)12-20(15)4/h5,7H,6,8-12H2,1-4H3,(H,18,19,21,23)/b7-5+/i4D3 |
| InChIKey | QQEKEXGBCRYWGQ-XLEWEENTSA-N |
| XLogP | 2.00 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|