C18H27N3O5 — CID 155163426
[(11E)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamic acid (PubChem CID 155163426) has the molecular formula C18H27N3O5 and a molecular weight of 368.45 g/mol. Its IUPAC name is [(11E)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamic acid.
| Compound Name | [(11E)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamic acid |
|---|---|
| PubChem CID | 155163426 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [(11E)-16-cyclopropyl-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadec-11-en-5-ylidene]carbamic acid |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OC(C2CC2)CCC/C=C/CCCC(=O)NC1=NC(=O)O |
| InChI | InChI=1S/C18H27N3O5/c1-21-12-16(23)26-14(13-10-11-13)8-6-4-2-3-5-7-9-15(22)19-17(21)20-18(24)25/h2-3,13-14H,4-12H2,1H3,(H,24,25)(H,19,20,22)/b3-2+/i1D3 |
| InChIKey | IBQOCXPTJXENFA-SMQGVBCRSA-N |
| XLogP | 2.30 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|