C24H31N3O5 — CID 155760058
benzyl (NZ)-N-[(14E)-5,10-dioxo-7-(trideuteriomethyl)-4-oxa-7,9-diazaspiro[2.15]octadec-14-en-8-ylidene]carbamate (PubChem CID 155760058) has the molecular formula C24H31N3O5 and a molecular weight of 444.55 g/mol. Its IUPAC name is benzyl (NZ)-N-[(14E)-5,10-dioxo-7-(trideuteriomethyl)-4-oxa-7,9-diazaspiro[2.15]octadec-14-en-8-ylidene]carbamate.
| Compound Name | benzyl (NZ)-N-[(14E)-5,10-dioxo-7-(trideuteriomethyl)-4-oxa-7,9-diazaspiro[2.15]octadec-14-en-8-ylidene]carbamate |
|---|---|
| PubChem CID | 155760058 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | benzyl (NZ)-N-[(14E)-5,10-dioxo-7-(trideuteriomethyl)-4-oxa-7,9-diazaspiro[2.15]octadec-14-en-8-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1CC(=O)OC2(CCC/C=C/CCCC(=O)N/C1=N/C(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C24H31N3O5/c1-27-17-21(29)32-24(15-16-24)14-10-5-3-2-4-9-13-20(28)25-22(27)26-23(30)31-18-19-11-7-6-8-12-19/h2-3,6-8,11-12H,4-5,9-10,13-18H2,1H3,(H,25,26,28,30)/b3-2+/i1D3 |
| InChIKey | YEWWWAYHQNDQAN-SMQGVBCRSA-N |
| XLogP | 3.71 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|