C23H40N6O5 — CID 172771476
tert-butyl N-[(15E)-3-(diaminomethylideneamino)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclononadec-15-en-5-ylidene]carbamate (PubChem CID 172771476) has the molecular formula C23H40N6O5 and a molecular weight of 483.63 g/mol. Its IUPAC name is tert-butyl N-[(15E)-3-(diaminomethylideneamino)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclononadec-15-en-5-ylidene]carbamate.
| Compound Name | tert-butyl N-[(15E)-3-(diaminomethylideneamino)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclononadec-15-en-5-ylidene]carbamate |
|---|---|
| PubChem CID | 172771476 |
| Molecular Formula | C23H40N6O5 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | tert-butyl N-[(15E)-3-(diaminomethylideneamino)-2,7-dioxo-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclononadec-15-en-5-ylidene]carbamate |
| SMILES | [2H]C([2H])([2H])N1C(=NC(=O)OC(C)(C)C)NC(=O)CCCCCCC/C=C/CCCOC(=O)C1N=C(N)N |
| InChI | InChI=1S/C23H40N6O5/c1-23(2,3)34-22(32)28-21-26-17(30)15-13-11-9-7-5-6-8-10-12-14-16-33-19(31)18(29(21)4)27-20(24)25/h8,10,18H,5-7,9,11-16H2,1-4H3,(H4,24,25,27)(H,26,28,30,32)/b10-8+/i4D3 |
| InChIKey | MZYCYIWGJDQSGS-DXNLXGJLSA-N |
| XLogP | 2.55 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|