C17H31N3O3 — CID 155760101
17-ethyl-5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadecane-2,7-dione (PubChem CID 155760101) has the molecular formula C17H31N3O3 and a molecular weight of 328.47 g/mol. Its IUPAC name is 17-ethyl-5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadecane-2,7-dione.
| Compound Name | 17-ethyl-5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadecane-2,7-dione |
|---|---|
| PubChem CID | 155760101 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 17-ethyl-5-imino-4-(trideuteriomethyl)-1-oxa-4,6-diazacycloheptadecane-2,7-dione |
| SMILES | [H]/N=C1\NC(=O)CCCCCCCCCC(CC)OC(=O)CN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H31N3O3/c1-3-14-11-9-7-5-4-6-8-10-12-15(21)19-17(18)20(2)13-16(22)23-14/h14H,3-13H2,1-2H3,(H2,18,19,21)/i2D3 |
| InChIKey | GPQRHMQUYDTPBD-BMSJAHLVSA-N |
| XLogP | 2.82 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|