C16H30ClN3O3 — CID 155163465
(17R)-5-imino-4,17-dimethyl-1-oxa-4,6-diazacycloheptadecane-2,7-dione;hydrochloride (PubChem CID 155163465) has the molecular formula C16H30ClN3O3 and a molecular weight of 347.89 g/mol. Its IUPAC name is (17R)-5-imino-4,17-dimethyl-1-oxa-4,6-diazacycloheptadecane-2,7-dione;hydrochloride.
| Compound Name | (17R)-5-imino-4,17-dimethyl-1-oxa-4,6-diazacycloheptadecane-2,7-dione;hydrochloride |
|---|---|
| PubChem CID | 155163465 |
| Molecular Formula | C16H30ClN3O3 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (17R)-5-imino-4,17-dimethyl-1-oxa-4,6-diazacycloheptadecane-2,7-dione;hydrochloride |
| SMILES | Cl.[H]/N=C1\NC(=O)CCCCCCCCC[C@@H](C)OC(=O)CN1C |
| InChI | InChI=1S/C16H29N3O3.ClH/c1-13-10-8-6-4-3-5-7-9-11-14(20)18-16(17)19(2)12-15(21)22-13;/h13H,3-12H2,1-2H3,(H2,17,18,20);1H/t13-;/m1./s1 |
| InChIKey | XLMHRNXWGZFHDO-BTQNPOSSSA-N |
| XLogP | 2.85 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|