C18H31N3O4 — CID 147085463
10-imino-9-methyl-2,6-dioxa-9,11-diazaspiro[4.16]henicosane-7,12-dione (PubChem CID 147085463) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 10-imino-9-methyl-2,6-dioxa-9,11-diazaspiro[4.16]henicosane-7,12-dione.
| Compound Name | 10-imino-9-methyl-2,6-dioxa-9,11-diazaspiro[4.16]henicosane-7,12-dione |
|---|---|
| PubChem CID | 147085463 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 10-imino-9-methyl-2,6-dioxa-9,11-diazaspiro[4.16]henicosane-7,12-dione |
| SMILES | [H]/N=C1/NC(=O)CCCCCCCCCC2(CCOC2)OC(=O)CN1C |
| InChI | InChI=1S/C18H31N3O4/c1-21-13-16(23)25-18(11-12-24-14-18)10-8-6-4-2-3-5-7-9-15(22)20-17(21)19/h2-14H2,1H3,(H2,19,20,22) |
| InChIKey | BHTDJUVSDBFFHO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|