C14H25N3O3 — CID 155163343
5-imino-15-methyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadecane-2,7-dione (PubChem CID 155163343) has the molecular formula C14H25N3O3 and a molecular weight of 286.39 g/mol. Its IUPAC name is 5-imino-15-methyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadecane-2,7-dione.
| Compound Name | 5-imino-15-methyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadecane-2,7-dione |
|---|---|
| PubChem CID | 155163343 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 5-imino-15-methyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclopentadecane-2,7-dione |
| SMILES | [H]/N=C1\NC(=O)CCCCCCCC(C)OC(=O)CN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H25N3O3/c1-11-8-6-4-3-5-7-9-12(18)16-14(15)17(2)10-13(19)20-11/h11H,3-10H2,1-2H3,(H2,15,16,18)/i2D3 |
| InChIKey | GOJICNYKOOZSCN-BMSJAHLVSA-N |
| XLogP | 1.65 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|